C29H36N2O3S — CID 123551670
3-[[1-benzyl-7-[4-(cyclopropylmethylsulfonyl)butyl]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]oxetane-3-carbonitrile (PubChem CID 123551670) has the molecular formula C29H36N2O3S and a molecular weight of 492.69 g/mol. Its IUPAC name is 3-[[1-benzyl-7-[4-(cyclopropylmethylsulfonyl)butyl]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]oxetane-3-carbonitrile.
| Compound Name | 3-[[1-benzyl-7-[4-(cyclopropylmethylsulfonyl)butyl]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 123551670 |
| Molecular Formula | C29H36N2O3S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 3-[[1-benzyl-7-[4-(cyclopropylmethylsulfonyl)butyl]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]oxetane-3-carbonitrile |
| SMILES | N#CC1(NC2CCc3ccc(CCCCS(=O)(=O)CC4CC4)cc3C2Cc2ccccc2)COC1 |
| InChI | InChI=1S/C29H36N2O3S/c30-19-29(20-34-21-29)31-28-14-13-25-12-11-23(8-4-5-15-35(32,33)18-24-9-10-24)16-26(25)27(28)17-22-6-2-1-3-7-22/h1-3,6-7,11-12,16,24,27-28,31H,4-5,8-10,13-15,17-18,20-21H2 |
| InChIKey | CBVDDJVNQIXXBA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|