C28H36F5NO4S — CID 158129859
1-[(3,4-difluorophenyl)methyl]-N-ethyl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 158129859) has the molecular formula C28H36F5NO4S and a molecular weight of 577.66 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-N-ethyl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-N-ethyl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158129859 |
| Molecular Formula | C28H36F5NO4S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-N-ethyl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCS(=O)(=O)CCCCc1ccc2c(c1)C(Cc1ccc(F)c(F)c1)C(NCC)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H35F2NO2S.C2HF3O2/c1-3-14-32(30,31)15-6-5-7-19-8-10-21-11-13-26(29-4-2)23(22(21)16-19)17-20-9-12-24(27)25(28)18-20;3-2(4,5)1(6)7/h8-10,12,16,18,23,26,29H,3-7,11,13-15,17H2,1-2H3;(H,6,7) |
| InChIKey | BFWKKIWMUCXUDA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|