C27H39NO2S — CID 159135670
1-benzyl-N-propan-2-yl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 159135670) has the molecular formula C27H39NO2S and a molecular weight of 441.68 g/mol. Its IUPAC name is 1-benzyl-N-propan-2-yl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 1-benzyl-N-propan-2-yl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 159135670 |
| Molecular Formula | C27H39NO2S |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 1-benzyl-N-propan-2-yl-7-(4-propylsulfonylbutyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCS(=O)(=O)CCCCc1ccc2c(c1)C(Cc1ccccc1)C(NC(C)C)CC2 |
| InChI | InChI=1S/C27H39NO2S/c1-4-17-31(29,30)18-9-8-12-23-13-14-24-15-16-27(28-21(2)3)26(25(24)19-23)20-22-10-6-5-7-11-22/h5-7,10-11,13-14,19,21,26-28H,4,8-9,12,15-18,20H2,1-3H3 |
| InChIKey | KHLNKTFYFNFUNS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|