C8H16O2+2 — CID 123552627
1,2,4,6-tetramethyl-2,3-dihydro-1,4-dioxine-1,4-diium (PubChem CID 123552627) has the molecular formula C8H16O2+2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 1,2,4,6-tetramethyl-2,3-dihydro-1,4-dioxine-1,4-diium.
| Compound Name | 1,2,4,6-tetramethyl-2,3-dihydro-1,4-dioxine-1,4-diium |
|---|---|
| PubChem CID | 123552627 |
| Molecular Formula | C8H16O2+2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 1,2,4,6-tetramethyl-2,3-dihydro-1,4-dioxine-1,4-diium |
| SMILES | CC1=C[O+](C)CC(C)[O+]1C |
| InChI | InChI=1S/C8H16O2/c1-7-5-9(3)6-8(2)10(7)4/h5,8H,6H2,1-4H3/q+2 |
| InChIKey | YOFPPHCWRPMVAK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 5.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|