C6H10O2 — CID 13441491
2,6-dimethyl-2,3-dihydro-1,4-dioxine (PubChem CID 13441491) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 2,6-dimethyl-2,3-dihydro-1,4-dioxine.
| Compound Name | 2,6-dimethyl-2,3-dihydro-1,4-dioxine |
|---|---|
| PubChem CID | 13441491 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 2,6-dimethyl-2,3-dihydro-1,4-dioxine |
| SMILES | CC1=COCC(C)O1 |
| InChI | InChI=1S/C6H10O2/c1-5-3-7-4-6(2)8-5/h3,6H,4H2,1-2H3 |
| InChIKey | KPWYQLMJBYDCHN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |