C7H14N2OS2 — CID 123553604
2-(disulfanyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 123553604) has the molecular formula C7H14N2OS2 and a molecular weight of 206.34 g/mol. Its IUPAC name is 2-(disulfanyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | 2-(disulfanyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 123553604 |
| Molecular Formula | C7H14N2OS2 |
| Molecular Weight | 206.34 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(disulfanyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | OC1CC2CN(SS)CCN2C1 |
| InChI | InChI=1S/C7H14N2OS2/c10-7-3-6-4-9(12-11)2-1-8(6)5-7/h6-7,10-11H,1-5H2 |
| InChIKey | KAXAENSQDQDRGJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|