C28H33FN4O6S — CID 123554141
4-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-2-fluorobenzenesulfonamide (PubChem CID 123554141) has the molecular formula C28H33FN4O6S and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 123554141 |
| Molecular Formula | C28H33FN4O6S |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 4-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-2-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2CC3CN(C(=O)c4cc(OCC5CCOCC5)nc(C5CC5)c4)CC3C2)cc1F |
| InChI | InChI=1S/C28H33FN4O6S/c29-23-9-19(3-4-25(23)40(30,36)37)27(34)32-12-21-14-33(15-22(21)13-32)28(35)20-10-24(18-1-2-18)31-26(11-20)39-16-17-5-7-38-8-6-17/h3-4,9-11,17-18,21-22H,1-2,5-8,12-16H2,(H2,30,36,37) |
| InChIKey | BUKSNFPTBVKTGZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |