C25H31FN4O3S2 — CID 142427628
[4-(4-aminosulfanyl-2-fluorophenyl)sulfanylpiperazin-1-yl]-[2-cyclopropyl-6-(oxan-4-ylmethoxy)-4-pyridinyl]methanone (PubChem CID 142427628) has the molecular formula C25H31FN4O3S2 and a molecular weight of 518.68 g/mol. Its IUPAC name is [4-(4-aminosulfanyl-2-fluorophenyl)sulfanylpiperazin-1-yl]-[2-cyclopropyl-6-(oxan-4-ylmethoxy)-4-pyridinyl]methanone.
| Compound Name | [4-(4-aminosulfanyl-2-fluorophenyl)sulfanylpiperazin-1-yl]-[2-cyclopropyl-6-(oxan-4-ylmethoxy)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 142427628 |
| Molecular Formula | C25H31FN4O3S2 |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | [4-(4-aminosulfanyl-2-fluorophenyl)sulfanylpiperazin-1-yl]-[2-cyclopropyl-6-(oxan-4-ylmethoxy)-4-pyridinyl]methanone |
| SMILES | NSc1ccc(SN2CCN(C(=O)c3cc(OCC4CCOCC4)nc(C4CC4)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H31FN4O3S2/c26-21-15-20(34-27)3-4-23(21)35-30-9-7-29(8-10-30)25(31)19-13-22(18-1-2-18)28-24(14-19)33-16-17-5-11-32-12-6-17/h3-4,13-15,17-18H,1-2,5-12,16,27H2 |
| InChIKey | OJQLUIVMNVXVSD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|