C28H33FN4O4S — CID 144930322
(4-aminosulfanyl-2-fluorophenyl)-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone (PubChem CID 144930322) has the molecular formula C28H33FN4O4S and a molecular weight of 540.66 g/mol. Its IUPAC name is (4-aminosulfanyl-2-fluorophenyl)-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone.
| Compound Name | (4-aminosulfanyl-2-fluorophenyl)-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 144930322 |
| Molecular Formula | C28H33FN4O4S |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | (4-aminosulfanyl-2-fluorophenyl)-[5-[2-cyclopropyl-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
| SMILES | NSc1ccc(C(=O)N2CC3CN(C(=O)c4cc(OCC5CCOCC5)nc(C5CC5)c4)CC3C2)c(F)c1 |
| InChI | InChI=1S/C28H33FN4O4S/c29-24-11-22(38-30)3-4-23(24)28(35)33-14-20-12-32(13-21(20)15-33)27(34)19-9-25(18-1-2-18)31-26(10-19)37-16-17-5-7-36-8-6-17/h3-4,9-11,17-18,20-21H,1-2,5-8,12-16,30H2 |
| InChIKey | LJXJLLCUNPVHKC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|