C11H11N2O3S- — CID 123554884
2-(2-phenylacetyl)-3,4-dihydropyrazole-5-sulfinate (PubChem CID 123554884) has the molecular formula C11H11N2O3S- and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(2-phenylacetyl)-3,4-dihydropyrazole-5-sulfinate.
| Compound Name | 2-(2-phenylacetyl)-3,4-dihydropyrazole-5-sulfinate |
|---|---|
| PubChem CID | 123554884 |
| Molecular Formula | C11H11N2O3S- |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-(2-phenylacetyl)-3,4-dihydropyrazole-5-sulfinate |
| SMILES | O=C(Cc1ccccc1)N1CCC(S(=O)[O-])=N1 |
| InChI | InChI=1S/C11H12N2O3S/c14-11(8-9-4-2-1-3-5-9)13-7-6-10(12-13)17(15)16/h1-5H,6-8H2,(H,15,16)/p-1 |
| InChIKey | AOJAZCVBAGHQLC-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|