C7H11N3 — CID 123556057
5,5-dimethyl-1,3-diazepin-2-amine (PubChem CID 123556057) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-diazepin-2-amine.
| Compound Name | 5,5-dimethyl-1,3-diazepin-2-amine |
|---|---|
| PubChem CID | 123556057 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 5,5-dimethyl-1,3-diazepin-2-amine |
| SMILES | CC1(C)C=CN=C(N)N=C1 |
| InChI | InChI=1S/C7H11N3/c1-7(2)3-4-9-6(8)10-5-7/h3-5H,1-2H3,(H2,8,9) |
| InChIKey | SEHQGBSIQMGXQO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |