C8H13N2+ — CID 145003298
1,5,5-trimethyl-1,3-diazepin-1-ium (PubChem CID 145003298) has the molecular formula C8H13N2+ and a molecular weight of 137.21 g/mol. Its IUPAC name is 1,5,5-trimethyl-1,3-diazepin-1-ium.
| Compound Name | 1,5,5-trimethyl-1,3-diazepin-1-ium |
|---|---|
| PubChem CID | 145003298 |
| Molecular Formula | C8H13N2+ |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | 1,5,5-trimethyl-1,3-diazepin-1-ium |
| SMILES | C[N+]1=CN=CC(C)(C)C=C1 |
| InChI | InChI=1S/C8H13N2/c1-8(2)4-5-10(3)7-9-6-8/h4-7H,1-3H3/q+1 |
| InChIKey | KQBFIZZTIWXYMJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|