C14H9F3N2O — CID 123558364
2-(1,3-difluorobuta-1,3-dien-2-yl)-3-(4-fluorophenyl)imidazole-4-carbaldehyde (PubChem CID 123558364) has the molecular formula C14H9F3N2O and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-(1,3-difluorobuta-1,3-dien-2-yl)-3-(4-fluorophenyl)imidazole-4-carbaldehyde.
| Compound Name | 2-(1,3-difluorobuta-1,3-dien-2-yl)-3-(4-fluorophenyl)imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 123558364 |
| Molecular Formula | C14H9F3N2O |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(1,3-difluorobuta-1,3-dien-2-yl)-3-(4-fluorophenyl)imidazole-4-carbaldehyde |
| SMILES | C=C(F)C(=CF)c1ncc(C=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H9F3N2O/c1-9(16)13(6-15)14-18-7-12(8-20)19(14)11-4-2-10(17)3-5-11/h2-8H,1H2 |
| InChIKey | HMJYTBVJAVNVOF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|