C7H4FN3O — CID 167346079
6-fluoroimidazo[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 167346079) has the molecular formula C7H4FN3O and a molecular weight of 165.13 g/mol. Its IUPAC name is 6-fluoroimidazo[1,2-a]pyrimidine-3-carbaldehyde.
| Compound Name | 6-fluoroimidazo[1,2-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 167346079 |
| Molecular Formula | C7H4FN3O |
| Molecular Weight | 165.13 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 6-fluoroimidazo[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | O=Cc1cnc2ncc(F)cn12 |
| InChI | InChI=1S/C7H4FN3O/c8-5-1-9-7-10-2-6(4-12)11(7)3-5/h1-4H |
| InChIKey | MMCXDWYFEMUTPC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.13 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|