C35H42BN3O4 — CID 123560784
tert-butyl 3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 123560784) has the molecular formula C35H42BN3O4 and a molecular weight of 579.55 g/mol. Its IUPAC name is tert-butyl 3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl 3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 123560784 |
| Molecular Formula | C35H42BN3O4 |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | tert-butyl 3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC2CC1C1N=C(c2ccc(-c3ccc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c3)cc2)CN1 |
| InChI | InChI=1S/C35H42BN3O4/c1-33(2,3)41-32(40)39-29-18-26(29)19-30(39)31-37-20-28(38-31)22-10-8-21(9-11-22)23-12-13-25-17-27(15-14-24(25)16-23)36-42-34(4,5)35(6,7)43-36/h8-17,26,29-31,37H,18-20H2,1-7H3 |
| InChIKey | OPITZDUYWKFBRN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|