C36H41BN2O4 — CID 58498952
tert-butyl (1R,3S,5R)-3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 58498952) has the molecular formula C36H41BN2O4 and a molecular weight of 576.55 g/mol. Its IUPAC name is tert-butyl (1R,3S,5R)-3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,5R)-3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 58498952 |
| Molecular Formula | C36H41BN2O4 |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | tert-butyl (1R,3S,5R)-3-[4-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C1=NC=C(c2ccc(-c3ccc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c3)cc2)C1 |
| InChI | InChI=1S/C36H41BN2O4/c1-34(2,3)41-33(40)39-31-19-27(31)20-32(39)30-18-28(21-38-30)23-10-8-22(9-11-23)24-12-13-26-17-29(15-14-25(26)16-24)37-42-35(4,5)36(6,7)43-37/h8-17,21,27,31-32H,18-20H2,1-7H3/t27-,31-,32+/m1/s1 |
| InChIKey | GFTCNNRNMGKJKE-HPENDQLSSA-N |
| XLogP | 7.39 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|