C39H52BN3O4 — CID 162071451
tert-butyl (2S)-2-[4-[4-[1'-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-piperidine]-4-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 162071451) has the molecular formula C39H52BN3O4 and a molecular weight of 637.67 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-[4-[1'-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-piperidine]-4-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-[4-[1'-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-piperidine]-4-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162071451 |
| Molecular Formula | C39H52BN3O4 |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.41 |
| IUPAC Name | tert-butyl (2S)-2-[4-[4-[1'-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-piperidine]-4-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CN1CCC2(CCc3c(B4OC(C)(C)C(C)(C)O4)ccc(-c4ccc(C5=CN=C([C@@H]6CCCN6C(=O)OC(C)(C)C)C5)cc4)c32)CC1 |
| InChI | InChI=1S/C39H52BN3O4/c1-36(2,3)45-35(44)43-21-9-10-33(43)32-24-28(25-41-32)26-11-13-27(14-12-26)29-15-16-31(40-46-37(4,5)38(6,7)47-40)30-17-18-39(34(29)30)19-22-42(8)23-20-39/h11-16,25,33H,9-10,17-24H2,1-8H3/t33-/m0/s1 |
| InChIKey | WZMZJBMZHXKCQN-XIFFEERXSA-N |
| XLogP | 7.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|