C30H37BN2O4 — CID 58499017
tert-butyl (1R,5R)-3-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 58499017) has the molecular formula C30H37BN2O4 and a molecular weight of 500.45 g/mol. Its IUPAC name is tert-butyl (1R,5R)-3-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,5R)-3-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 58499017 |
| Molecular Formula | C30H37BN2O4 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | tert-butyl (1R,5R)-3-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C2=NC=C(c3ccc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c3)C2)C[C@H]2C[C@H]21 |
| InChI | InChI=1S/C30H37BN2O4/c1-28(2,3)35-27(34)33-25-15-21(25)16-26(33)24-14-22(17-32-24)19-8-9-20-13-23(11-10-18(20)12-19)31-36-29(4,5)30(6,7)37-31/h8-13,17,21,25-26H,14-16H2,1-7H3/t21-,25-,26?/m1/s1 |
| InChIKey | RJUHZCJKLFQTPU-XSEHGGBNSA-N |
| XLogP | 5.72 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|