C32H41BN2O5 — CID 157395311
methyl (3S)-4-methyl-3-[(2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]pentanoate (PubChem CID 157395311) has the molecular formula C32H41BN2O5 and a molecular weight of 544.50 g/mol. Its IUPAC name is methyl (3S)-4-methyl-3-[(2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]pentanoate.
| Compound Name | methyl (3S)-4-methyl-3-[(2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]pentanoate |
|---|---|
| PubChem CID | 157395311 |
| Molecular Formula | C32H41BN2O5 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | methyl (3S)-4-methyl-3-[(2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]pentanoate |
| SMILES | COC(=O)C[C@H](C(=O)N1CCC[C@H]1C1=NC=C(c2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2)C1)C(C)C |
| InChI | InChI=1S/C32H41BN2O5/c1-20(2)26(18-29(36)38-7)30(37)35-14-8-9-28(35)27-17-24(19-34-27)22-10-11-23-16-25(13-12-21(23)15-22)33-39-31(3,4)32(5,6)40-33/h10-13,15-16,19-20,26,28H,8-9,14,17-18H2,1-7H3/t26-,28-/m0/s1 |
| InChIKey | BJNMVZYPJVQPGZ-XCZPVHLTSA-N |
| XLogP | 5.15 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|