C22H22N9S+ — CID 123562951
1-benzyl-4-[[5-[(1-benzyltriazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-2-ium-2-yl]methyl]triazole (PubChem CID 123562951) has the molecular formula C22H22N9S+ and a molecular weight of 444.55 g/mol. Its IUPAC name is 1-benzyl-4-[[5-[(1-benzyltriazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-2-ium-2-yl]methyl]triazole.
| Compound Name | 1-benzyl-4-[[5-[(1-benzyltriazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-2-ium-2-yl]methyl]triazole |
|---|---|
| PubChem CID | 123562951 |
| Molecular Formula | C22H22N9S+ |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-benzyl-4-[[5-[(1-benzyltriazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-2-ium-2-yl]methyl]triazole |
| SMILES | c1ccc(Cn2cc(CSc3nc[n+](Cc4cn(Cc5ccccc5)nn4)[nH]3)nn2)cc1 |
| InChI | InChI=1S/C22H21N9S/c1-3-7-18(8-4-1)11-29-13-20(24-27-29)14-31-17-23-22(26-31)32-16-21-15-30(28-25-21)12-19-9-5-2-6-10-19/h1-10,13,15,17H,11-12,14,16H2/p+1 |
| InChIKey | SLHLKKGYLWMGRF-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|