C23H26N6S — CID 155518726
2-[[1-[(1-benzylpiperidin-4-yl)methyl]triazol-4-yl]methylsulfanyl]-1H-benzimidazole (PubChem CID 155518726) has the molecular formula C23H26N6S and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[[1-[(1-benzylpiperidin-4-yl)methyl]triazol-4-yl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[[1-[(1-benzylpiperidin-4-yl)methyl]triazol-4-yl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 155518726 |
| Molecular Formula | C23H26N6S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[[1-[(1-benzylpiperidin-4-yl)methyl]triazol-4-yl]methylsulfanyl]-1H-benzimidazole |
| SMILES | c1ccc(CN2CCC(Cn3cc(CSc4nc5ccccc5[nH]4)nn3)CC2)cc1 |
| InChI | InChI=1S/C23H26N6S/c1-2-6-18(7-3-1)14-28-12-10-19(11-13-28)15-29-16-20(26-27-29)17-30-23-24-21-8-4-5-9-22(21)25-23/h1-9,16,19H,10-15,17H2,(H,24,25) |
| InChIKey | PPCLZSQPGRUGBH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |