C7H15N5 — CID 123563133
1-ethyl-5-imino-2-propan-2-yl-1,2,4-triazol-3-amine (PubChem CID 123563133) has the molecular formula C7H15N5 and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-ethyl-5-imino-2-propan-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 1-ethyl-5-imino-2-propan-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123563133 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 1-ethyl-5-imino-2-propan-2-yl-1,2,4-triazol-3-amine |
| SMILES | [H]/N=c1\nc(N)n(C(C)C)n1CC |
| InChI | InChI=1S/C7H15N5/c1-4-11-6(8)10-7(9)12(11)5(2)3/h5H,4H2,1-3H3,(H3,8,9,10) |
| InChIKey | NOWGRWZQVMPLEZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |