C7H17N5 — CID 142639925
3,4-di(propan-2-yl)-2H-tetrazol-5-amine (PubChem CID 142639925) has the molecular formula C7H17N5 and a molecular weight of 171.25 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-2H-tetrazol-5-amine.
| Compound Name | 3,4-di(propan-2-yl)-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 142639925 |
| Molecular Formula | C7H17N5 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 3,4-di(propan-2-yl)-2H-tetrazol-5-amine |
| SMILES | CC(C)N1NN=C(N)N1C(C)C |
| InChI | InChI=1S/C7H17N5/c1-5(2)11-7(8)9-10-12(11)6(3)4/h5-6,10H,1-4H3,(H2,8,9) |
| InChIKey | KZZAYGNFGHZQMT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |