C23H26N2O4 — CID 123563642
ethyl N-[(2R,4S)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-methylcarbamate (PubChem CID 123563642) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is ethyl N-[(2R,4S)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-methylcarbamate.
| Compound Name | ethyl N-[(2R,4S)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123563642 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | ethyl N-[(2R,4S)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)[C@H]1C[C@@H](C)N(C(C)=O)c2ccc(-c3ccc(C=O)cc3)cc21 |
| InChI | InChI=1S/C23H26N2O4/c1-5-29-23(28)24(4)22-12-15(2)25(16(3)27)21-11-10-19(13-20(21)22)18-8-6-17(14-26)7-9-18/h6-11,13-15,22H,5,12H2,1-4H3/t15-,22+/m1/s1 |
| InChIKey | IFNBYGJSDDKBBC-QRQCRPRQSA-N |
| XLogP | 4.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|