C23H26N2O4 — CID 86669443
[(2S,4R)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-propan-2-ylcarbamic acid (PubChem CID 86669443) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [(2S,4R)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-propan-2-ylcarbamic acid.
| Compound Name | [(2S,4R)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 86669443 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [(2S,4R)-1-acetyl-6-(4-formylphenyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-propan-2-ylcarbamic acid |
| SMILES | CC(=O)N1c2ccc(-c3ccc(C=O)cc3)cc2[C@H](N(C(=O)O)C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C23H26N2O4/c1-14(2)24(23(28)29)22-11-15(3)25(16(4)27)21-10-9-19(12-20(21)22)18-7-5-17(13-26)6-8-18/h5-10,12-15,22H,11H2,1-4H3,(H,28,29)/t15-,22+/m0/s1 |
| InChIKey | ONGFNDDEBLFZAK-OYHNWAKOSA-N |
| XLogP | 4.74 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|