About 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol
1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol (PubChem CID 123563855) has the molecular formula C17H37NS
and a molecular weight of 287.56 g/mol. Its IUPAC name is 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol.
Molecular Properties
| Compound Name | 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol |
| PubChem CID | 123563855 |
| Molecular Formula | C17H37NS |
| Molecular Weight | 287.56 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol |
| SMILES | CCCC(C)C(CCC)C(C)CC(S)CCNCC |
| InChI | InChI=1S/C17H37NS/c1-6-9-14(4)17(10-7-2)15(5)13-16(19)11-12-18-8-3/h14-19H,6-13H2,1-5H3 |
| InChIKey | QVMPFWWDDTZCQJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol?
The IUPAC name of 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol (CID 123563855) is 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol.
What is the SMILES notation for 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol?
The canonical SMILES for 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol is CCCC(C)C(CCC)C(C)CC(S)CCNCC.
What is the InChIKey of 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol?
The InChIKey is QVMPFWWDDTZCQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37NS/c1-6-9-14(4)17(10-7-2)15(5)13-16(19)11-12-18-8-3/h14-19H,6-13H2,1-5H3.
What are the key properties of 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol?
1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol has a molecular weight of 287.56 g/mol, XLogP of 5.16, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)-5,7-dimethyl-6-propyldecane-3-thiol is sourced from PubChem (CID 123563855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).