C11H16 — CID 123564080
8,9-dimethyldispiro[2.1.25.23]non-8-ene (PubChem CID 123564080) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 8,9-dimethyldispiro[2.1.25.23]non-8-ene.
| Compound Name | 8,9-dimethyldispiro[2.1.25.23]non-8-ene |
|---|---|
| PubChem CID | 123564080 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 8,9-dimethyldispiro[2.1.25.23]non-8-ene |
| SMILES | CC1=C(C)C2(CC2)CC12CC2 |
| InChI | InChI=1S/C11H16/c1-8-9(2)11(5-6-11)7-10(8)3-4-10/h3-7H2,1-2H3 |
| InChIKey | ITHVGZQCGKHHRN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|