C19H40 — CID 123564217
4-butan-2-yl-4-ethyl-2,2,3,3,5,6-hexamethylheptane (PubChem CID 123564217) has the molecular formula C19H40 and a molecular weight of 268.53 g/mol. Its IUPAC name is 4-butan-2-yl-4-ethyl-2,2,3,3,5,6-hexamethylheptane.
| Compound Name | 4-butan-2-yl-4-ethyl-2,2,3,3,5,6-hexamethylheptane |
|---|---|
| PubChem CID | 123564217 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 4-butan-2-yl-4-ethyl-2,2,3,3,5,6-hexamethylheptane |
| SMILES | CCC(C)C(CC)(C(C)C(C)C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40/c1-12-15(5)19(13-2,16(6)14(3)4)18(10,11)17(7,8)9/h14-16H,12-13H2,1-11H3 |
| InChIKey | DIVYBKMBXDFOJJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |