C42H61N3O6 — CID 123564953
methyl 2-[(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carbonyl)amino]-6-formamido-3,3,5-trimethylhexanoate (PubChem CID 123564953) has the molecular formula C42H61N3O6 and a molecular weight of 703.97 g/mol. Its IUPAC name is methyl 2-[(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carbonyl)amino]-6-formamido-3,3,5-trimethylhexanoate.
| Compound Name | methyl 2-[(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carbonyl)amino]-6-formamido-3,3,5-trimethylhexanoate |
|---|---|
| PubChem CID | 123564953 |
| Molecular Formula | C42H61N3O6 |
| Molecular Weight | 703.97 g/mol |
| Exact Mass | 703.46 |
| IUPAC Name | methyl 2-[(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carbonyl)amino]-6-formamido-3,3,5-trimethylhexanoate |
| SMILES | COC(=O)C(NC(=O)C12CCC(C)(C)CC1C1C(=O)C=C3C4(C)C=C(C#N)C(=O)C(C)(C)C4CCC3(C)C1(C)CC2)C(C)(C)CC(C)CNC=O |
| InChI | InChI=1S/C42H61N3O6/c1-25(23-44-24-46)19-37(4,5)32(34(49)51-11)45-35(50)42-16-14-36(2,3)21-27(42)31-28(47)18-30-39(8)20-26(22-43)33(48)38(6,7)29(39)12-13-40(30,9)41(31,10)15-17-42/h18,20,24-25,27,29,31-32H,12-17,19,21,23H2,1-11H3,(H,44,46)(H,45,50) |
| InChIKey | TXFPBUVZMJJQNE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.97 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|