C21H23FN2O4 — CID 123566104
ethyl 1-benzamido-3-(5-fluorohepta-1,3,5-trien-2-yl)-5-oxopyrrolidine-2-carboxylate (PubChem CID 123566104) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is ethyl 1-benzamido-3-(5-fluorohepta-1,3,5-trien-2-yl)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-benzamido-3-(5-fluorohepta-1,3,5-trien-2-yl)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123566104 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | ethyl 1-benzamido-3-(5-fluorohepta-1,3,5-trien-2-yl)-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=C(C=CC(F)=CC)C1CC(=O)N(NC(=O)c2ccccc2)C1C(=O)OCC |
| InChI | InChI=1S/C21H23FN2O4/c1-4-16(22)12-11-14(3)17-13-18(25)24(19(17)21(27)28-5-2)23-20(26)15-9-7-6-8-10-15/h4,6-12,17,19H,3,5,13H2,1-2H3,(H,23,26) |
| InChIKey | VPKDWORNODQICM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|