C22H36N2O3 — CID 123567507
tert-butyl (2R)-2-[(2S,5S)-2-tert-butyl-5-ethenylpyrrolidine-1-carbonyl]-2-ethenylpyrrolidine-1-carboxylate (PubChem CID 123567507) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2S,5S)-2-tert-butyl-5-ethenylpyrrolidine-1-carbonyl]-2-ethenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(2S,5S)-2-tert-butyl-5-ethenylpyrrolidine-1-carbonyl]-2-ethenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123567507 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | tert-butyl (2R)-2-[(2S,5S)-2-tert-butyl-5-ethenylpyrrolidine-1-carbonyl]-2-ethenylpyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1CC[C@@H](C(C)(C)C)N1C(=O)[C@]1(C=C)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H36N2O3/c1-9-16-12-13-17(20(3,4)5)24(16)18(25)22(10-2)14-11-15-23(22)19(26)27-21(6,7)8/h9-10,16-17H,1-2,11-15H2,3-8H3/t16-,17+,22+/m1/s1 |
| InChIKey | MHEWJQOMWIOMLH-JLHGSKIFSA-N |
| XLogP | 4.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|