C9H15N — CID 123570067
4,4-dimethyl-3,5-dihydro-2H-azocine (PubChem CID 123570067) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 4,4-dimethyl-3,5-dihydro-2H-azocine.
| Compound Name | 4,4-dimethyl-3,5-dihydro-2H-azocine |
|---|---|
| PubChem CID | 123570067 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 4,4-dimethyl-3,5-dihydro-2H-azocine |
| SMILES | CC1(C)CC=C/C=N\CC1 |
| InChI | InChI=1S/C9H15N/c1-9(2)5-3-4-7-10-8-6-9/h3-4,7H,5-6,8H2,1-2H3/b4-3?,10-7- |
| InChIKey | ZLMNEBYDGPMFER-YCBAEPLGSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |