C22H21F2N3O3Si — CID 123570183
5-[2-(2,4-difluorophenoxy)-5-(ethyl-hydroxy-methylsilyl)phenyl]-7-methylimidazo[1,5-a]pyrazin-8-one (PubChem CID 123570183) has the molecular formula C22H21F2N3O3Si and a molecular weight of 441.51 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenoxy)-5-(ethyl-hydroxy-methylsilyl)phenyl]-7-methylimidazo[1,5-a]pyrazin-8-one.
| Compound Name | 5-[2-(2,4-difluorophenoxy)-5-(ethyl-hydroxy-methylsilyl)phenyl]-7-methylimidazo[1,5-a]pyrazin-8-one |
|---|---|
| PubChem CID | 123570183 |
| Molecular Formula | C22H21F2N3O3Si |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 5-[2-(2,4-difluorophenoxy)-5-(ethyl-hydroxy-methylsilyl)phenyl]-7-methylimidazo[1,5-a]pyrazin-8-one |
| SMILES | CC[Si](C)(O)c1ccc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3cncn23)c1 |
| InChI | InChI=1S/C22H21F2N3O3Si/c1-4-31(3,29)15-6-8-20(30-21-7-5-14(23)9-17(21)24)16(10-15)19-12-26(2)22(28)18-11-25-13-27(18)19/h5-13,29H,4H2,1-3H3 |
| InChIKey | IXLHFMZKCSUDGZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|