C15H23N — CID 123571075
8-cyclohexyl-4a,5,6,7,8,8a-hexahydroquinoline (PubChem CID 123571075) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 8-cyclohexyl-4a,5,6,7,8,8a-hexahydroquinoline.
| Compound Name | 8-cyclohexyl-4a,5,6,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 123571075 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 8-cyclohexyl-4a,5,6,7,8,8a-hexahydroquinoline |
| SMILES | C1=CC2CCCC(C3CCCCC3)C2N=C1 |
| InChI | InChI=1S/C15H23N/c1-2-6-12(7-3-1)14-10-4-8-13-9-5-11-16-15(13)14/h5,9,11-15H,1-4,6-8,10H2 |
| InChIKey | QRHAZIWMPPCYBX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |