C14H23N — CID 123827757
8-pentan-3-yl-4a,5,6,7,8,8a-hexahydroquinoline (PubChem CID 123827757) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 8-pentan-3-yl-4a,5,6,7,8,8a-hexahydroquinoline.
| Compound Name | 8-pentan-3-yl-4a,5,6,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 123827757 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 8-pentan-3-yl-4a,5,6,7,8,8a-hexahydroquinoline |
| SMILES | CCC(CC)C1CCCC2C=CC=NC21 |
| InChI | InChI=1S/C14H23N/c1-3-11(4-2)13-9-5-7-12-8-6-10-15-14(12)13/h6,8,10-14H,3-5,7,9H2,1-2H3 |
| InChIKey | MESOYKVFSZXAOH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |