C12H17N — CID 143683325
2-(4-methylcyclohex-2-en-1-yl)-2,3-dihydropyridine (PubChem CID 143683325) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 2-(4-methylcyclohex-2-en-1-yl)-2,3-dihydropyridine.
| Compound Name | 2-(4-methylcyclohex-2-en-1-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 143683325 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-(4-methylcyclohex-2-en-1-yl)-2,3-dihydropyridine |
| SMILES | CC1C=CC(C2CC=CC=N2)CC1 |
| InChI | InChI=1S/C12H17N/c1-10-5-7-11(8-6-10)12-4-2-3-9-13-12/h2-3,5,7,9-12H,4,6,8H2,1H3 |
| InChIKey | DZQBMINYUCNFTB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|