C9H14N2 — CID 123571290
2,2-dimethyl-7,8-dihydro-1,5-diazonine (PubChem CID 123571290) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,2-dimethyl-7,8-dihydro-1,5-diazonine.
| Compound Name | 2,2-dimethyl-7,8-dihydro-1,5-diazonine |
|---|---|
| PubChem CID | 123571290 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,2-dimethyl-7,8-dihydro-1,5-diazonine |
| SMILES | CC1(C)C=C/N=C\CC/C=N\1 |
| InChI | InChI=1S/C9H14N2/c1-9(2)5-8-10-6-3-4-7-11-9/h5-8H,3-4H2,1-2H3/b8-5?,10-6-,11-7- |
| InChIKey | RIEUTOKZDRNINO-NQTXCHCQSA-N |
| XLogP | 2.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |