C10H16N2 — CID 138463401
(3Z)-2,2,7,7-tetramethyl-1,5-diazocine (PubChem CID 138463401) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (3Z)-2,2,7,7-tetramethyl-1,5-diazocine.
| Compound Name | (3Z)-2,2,7,7-tetramethyl-1,5-diazocine |
|---|---|
| PubChem CID | 138463401 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (3Z)-2,2,7,7-tetramethyl-1,5-diazocine |
| SMILES | CC1(C)/C=N\C=C/C(C)(C)/N=C\1 |
| InChI | InChI=1S/C10H16N2/c1-9(2)7-11-6-5-10(3,4)12-8-9/h5-8H,1-4H3/b6-5-,11-7-,12-8- |
| InChIKey | WYQZDQCVEJKVGY-FHJLVZHCSA-N |
| XLogP | 2.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |