C17H13N3O5S — CID 123572189
1-[2-(benzenesulfonyl)phenyl]-5-hydroxy-4-oxopyridazine-3-carboxamide (PubChem CID 123572189) has the molecular formula C17H13N3O5S and a molecular weight of 371.37 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)phenyl]-5-hydroxy-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-[2-(benzenesulfonyl)phenyl]-5-hydroxy-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 123572189 |
| Molecular Formula | C17H13N3O5S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1-[2-(benzenesulfonyl)phenyl]-5-hydroxy-4-oxopyridazine-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccccc2S(=O)(=O)c2ccccc2)cc(O)c1=O |
| InChI | InChI=1S/C17H13N3O5S/c18-17(23)15-16(22)13(21)10-20(19-15)12-8-4-5-9-14(12)26(24,25)11-6-2-1-3-7-11/h1-10,21H,(H2,18,23) |
| InChIKey | RIGVVPICOZTZKX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |