C10H22O4Si2 — CID 123576735
[2-(hydroxymethylsilyl)-1-trimethylsilyloxyethyl] 2-methylprop-2-enoate (PubChem CID 123576735) has the molecular formula C10H22O4Si2 and a molecular weight of 262.45 g/mol. Its IUPAC name is [2-(hydroxymethylsilyl)-1-trimethylsilyloxyethyl] 2-methylprop-2-enoate.
| Compound Name | [2-(hydroxymethylsilyl)-1-trimethylsilyloxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123576735 |
| Molecular Formula | C10H22O4Si2 |
| Molecular Weight | 262.45 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [2-(hydroxymethylsilyl)-1-trimethylsilyloxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C[SiH2]CO)O[Si](C)(C)C |
| InChI | InChI=1S/C10H22O4Si2/c1-8(2)10(12)13-9(6-15-7-11)14-16(3,4)5/h9,11H,1,6-7,15H2,2-5H3 |
| InChIKey | WDNDUWFWLGVOSP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|