C17H24N2O2 — CID 123576857
(2,6-dimethylphenyl) N-(8-aminocyclooct-4-en-1-yl)carbamate (PubChem CID 123576857) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-(8-aminocyclooct-4-en-1-yl)carbamate.
| Compound Name | (2,6-dimethylphenyl) N-(8-aminocyclooct-4-en-1-yl)carbamate |
|---|---|
| PubChem CID | 123576857 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2,6-dimethylphenyl) N-(8-aminocyclooct-4-en-1-yl)carbamate |
| SMILES | Cc1cccc(C)c1OC(=O)NC1CCC=CCCC1N |
| InChI | InChI=1S/C17H24N2O2/c1-12-8-7-9-13(2)16(12)21-17(20)19-15-11-6-4-3-5-10-14(15)18/h3-4,7-9,14-15H,5-6,10-11,18H2,1-2H3,(H,19,20) |
| InChIKey | JAINIVUPXBKMEM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|