C19H28N2O5 — CID 123601824
(3,4,5-trimethoxyphenyl)methyl N-[(1S,8S)-8-aminocyclooct-4-en-1-yl]carbamate (PubChem CID 123601824) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl N-[(1S,8S)-8-aminocyclooct-4-en-1-yl]carbamate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl N-[(1S,8S)-8-aminocyclooct-4-en-1-yl]carbamate |
|---|---|
| PubChem CID | 123601824 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl N-[(1S,8S)-8-aminocyclooct-4-en-1-yl]carbamate |
| SMILES | COc1cc(COC(=O)N[C@H]2CCC=CCC[C@@H]2N)cc(OC)c1OC |
| InChI | InChI=1S/C19H28N2O5/c1-23-16-10-13(11-17(24-2)18(16)25-3)12-26-19(22)21-15-9-7-5-4-6-8-14(15)20/h4-5,10-11,14-15H,6-9,12,20H2,1-3H3,(H,21,22)/t14-,15-/m0/s1 |
| InChIKey | MXLMRIWYDJDTGU-GJZGRUSLSA-N |
| XLogP | 2.76 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|