C27H29Cl2NO3 — CID 123577363
[4-[4-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]but-1-en-2-yl]-2-methylphenyl] butanoate (PubChem CID 123577363) has the molecular formula C27H29Cl2NO3 and a molecular weight of 486.44 g/mol. Its IUPAC name is [4-[4-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]but-1-en-2-yl]-2-methylphenyl] butanoate.
| Compound Name | [4-[4-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]but-1-en-2-yl]-2-methylphenyl] butanoate |
|---|---|
| PubChem CID | 123577363 |
| Molecular Formula | C27H29Cl2NO3 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [4-[4-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]but-1-en-2-yl]-2-methylphenyl] butanoate |
| SMILES | C=C(CCc1nc(-c2ccc(Cl)cc2Cl)oc1C(C)C)c1ccc(OC(=O)CCC)c(C)c1 |
| InChI | InChI=1S/C27H29Cl2NO3/c1-6-7-25(31)32-24-13-9-19(14-18(24)5)17(4)8-12-23-26(16(2)3)33-27(30-23)21-11-10-20(28)15-22(21)29/h9-11,13-16H,4,6-8,12H2,1-3,5H3 |
| InChIKey | VVHSMZAOQLAGIB-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|