C28H29Cl2NO5 — CID 67419197
2-[4-[3-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]propanoyl]-2-prop-2-enylphenoxy]ethyl acetate (PubChem CID 67419197) has the molecular formula C28H29Cl2NO5 and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[4-[3-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]propanoyl]-2-prop-2-enylphenoxy]ethyl acetate.
| Compound Name | 2-[4-[3-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]propanoyl]-2-prop-2-enylphenoxy]ethyl acetate |
|---|---|
| PubChem CID | 67419197 |
| Molecular Formula | C28H29Cl2NO5 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 2-[4-[3-[2-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-oxazol-4-yl]propanoyl]-2-prop-2-enylphenoxy]ethyl acetate |
| SMILES | C=CCc1cc(C(=O)CCc2nc(-c3ccc(Cl)cc3Cl)oc2C(C)C)ccc1OCCOC(C)=O |
| InChI | InChI=1S/C28H29Cl2NO5/c1-5-6-20-15-19(7-12-26(20)35-14-13-34-18(4)32)25(33)11-10-24-27(17(2)3)36-28(31-24)22-9-8-21(29)16-23(22)30/h5,7-9,12,15-17H,1,6,10-11,13-14H2,2-4H3 |
| InChIKey | NKNZKKBAULJYPC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|