C19H15Cl2NO2S — CID 142921169
3-[2-(2,4-dichlorophenyl)-5-methyl-1,3-oxazol-4-yl]-1-(4-sulfanylphenyl)propan-1-one (PubChem CID 142921169) has the molecular formula C19H15Cl2NO2S and a molecular weight of 392.31 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)-5-methyl-1,3-oxazol-4-yl]-1-(4-sulfanylphenyl)propan-1-one.
| Compound Name | 3-[2-(2,4-dichlorophenyl)-5-methyl-1,3-oxazol-4-yl]-1-(4-sulfanylphenyl)propan-1-one |
|---|---|
| PubChem CID | 142921169 |
| Molecular Formula | C19H15Cl2NO2S |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)-5-methyl-1,3-oxazol-4-yl]-1-(4-sulfanylphenyl)propan-1-one |
| SMILES | Cc1oc(-c2ccc(Cl)cc2Cl)nc1CCC(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C19H15Cl2NO2S/c1-11-17(8-9-18(23)12-2-5-14(25)6-3-12)22-19(24-11)15-7-4-13(20)10-16(15)21/h2-7,10,25H,8-9H2,1H3 |
| InChIKey | SVQHVVOFRKEZRR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|