C7H13NO — CID 123578504
(2S)-2-[(2R)-2,5-dihydrofuran-2-yl]propan-1-amine (PubChem CID 123578504) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (2S)-2-[(2R)-2,5-dihydrofuran-2-yl]propan-1-amine.
| Compound Name | (2S)-2-[(2R)-2,5-dihydrofuran-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 123578504 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (2S)-2-[(2R)-2,5-dihydrofuran-2-yl]propan-1-amine |
| SMILES | C[C@@H](CN)[C@H]1C=CCO1 |
| InChI | InChI=1S/C7H13NO/c1-6(5-8)7-3-2-4-9-7/h2-3,6-7H,4-5,8H2,1H3/t6-,7+/m0/s1 |
| InChIKey | MJCYCIDKRVXENY-NKWVEPMBSA-N |
| XLogP | 0.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|