C7H11F2NO — CID 58208591
(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine (PubChem CID 58208591) has the molecular formula C7H11F2NO and a molecular weight of 163.17 g/mol. Its IUPAC name is (2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine.
| Compound Name | (2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 58208591 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine |
| SMILES | NC[C@H](C(F)F)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C7H11F2NO/c8-7(9)5(4-10)6-2-1-3-11-6/h1-2,5-7H,3-4,10H2/t5-,6-/m0/s1 |
| InChIKey | GKNDOXVUJCHNNU-WDSKDSINSA-N |
| XLogP | 0.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|