C22H22FNO3 — CID 123579537
2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetic acid (PubChem CID 123579537) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetic acid.
| Compound Name | 2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 123579537 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetic acid |
| SMILES | O=C(O)C(c1ccc(Cn2cc3c(F)cccc3c2O)cc1)C1CCCC1 |
| InChI | InChI=1S/C22H22FNO3/c23-19-7-3-6-17-18(19)13-24(21(17)25)12-14-8-10-16(11-9-14)20(22(26)27)15-4-1-2-5-15/h3,6-11,13,15,20,25H,1-2,4-5,12H2,(H,26,27) |
| InChIKey | SOSAALCVYQWXRE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |