C17H20N2OS — CID 123579549
3-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]but-3-en-2-one (PubChem CID 123579549) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]but-3-en-2-one.
| Compound Name | 3-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 123579549 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)c1csc(Nc2c(CC)cccc2CC)n1 |
| InChI | InChI=1S/C17H20N2OS/c1-5-13-8-7-9-14(6-2)16(13)19-17-18-15(10-21-17)11(3)12(4)20/h7-10H,3,5-6H2,1-2,4H3,(H,18,19) |
| InChIKey | OIFMHRDKQTVVCI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|