C26H27ClFNO4 — CID 123582749
(2R,3R)-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-8-(4-fluorophenyl)-2,3-dihydroxy-6,6-dimethyloct-7-yne-1,4-dione (PubChem CID 123582749) has the molecular formula C26H27ClFNO4 and a molecular weight of 471.96 g/mol. Its IUPAC name is (2R,3R)-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-8-(4-fluorophenyl)-2,3-dihydroxy-6,6-dimethyloct-7-yne-1,4-dione.
| Compound Name | (2R,3R)-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-8-(4-fluorophenyl)-2,3-dihydroxy-6,6-dimethyloct-7-yne-1,4-dione |
|---|---|
| PubChem CID | 123582749 |
| Molecular Formula | C26H27ClFNO4 |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (2R,3R)-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-8-(4-fluorophenyl)-2,3-dihydroxy-6,6-dimethyloct-7-yne-1,4-dione |
| SMILES | CC(C)(C#Cc1ccc(F)cc1)CC(=O)[C@H](O)[C@@H](O)C(=O)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H27ClFNO4/c1-26(2,13-12-17-8-10-20(28)11-9-17)16-22(30)23(31)24(32)25(33)29-14-4-7-21(29)18-5-3-6-19(27)15-18/h3,5-6,8-11,15,21,23-24,31-32H,4,7,14,16H2,1-2H3/t21?,23-,24+/m0/s1 |
| InChIKey | BSGODMIOUWXLCS-RPFBHVFUSA-N |
| XLogP | 3.90 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|